C19H21N5O6S2 — CID 87884674
S-[1-[4-[ethyl-[(4-nitrophenyl)methoxycarbonylamino]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate (PubChem CID 87884674) has the molecular formula C19H21N5O6S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is S-[1-[4-[ethyl-[(4-nitrophenyl)methoxycarbonylamino]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate.
| Compound Name | S-[1-[4-[ethyl-[(4-nitrophenyl)methoxycarbonylamino]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 87884674 |
| Molecular Formula | C19H21N5O6S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | S-[1-[4-[ethyl-[(4-nitrophenyl)methoxycarbonylamino]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] ethanethioate |
| SMILES | CCN(NC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)c1csc(N2CC(SC(C)=O)C2)n1 |
| InChI | InChI=1S/C19H21N5O6S2/c1-3-23(21-19(27)30-10-13-4-6-14(7-5-13)24(28)29)17(26)16-11-31-18(20-16)22-8-15(9-22)32-12(2)25/h4-7,11,15H,3,8-10H2,1-2H3,(H,21,27) |
| InChIKey | RZCPZBOVHDXVLT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|