C19H23N5O8S2 — CID 22242994
[1-[4-[methyl-[2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate (PubChem CID 22242994) has the molecular formula C19H23N5O8S2 and a molecular weight of 513.55 g/mol. Its IUPAC name is [1-[4-[methyl-[2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate.
| Compound Name | [1-[4-[methyl-[2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 22242994 |
| Molecular Formula | C19H23N5O8S2 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | [1-[4-[methyl-[2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]carbamoyl]-1,3-thiazol-2-yl]azetidin-3-yl] methanesulfonate |
| SMILES | CN(CCNC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)c1csc(N2CC(OS(C)(=O)=O)C2)n1 |
| InChI | InChI=1S/C19H23N5O8S2/c1-22(8-7-20-19(26)31-11-13-3-5-14(6-4-13)24(27)28)17(25)16-12-33-18(21-16)23-9-15(10-23)32-34(2,29)30/h3-6,12,15H,7-11H2,1-2H3,(H,20,26) |
| InChIKey | TYQJKYYMAIXDIG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 161.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|