C20H24N4O8S2 — CID 22243033
(4-nitrophenyl)methyl 2-[[2-(3-methylsulfonyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]-propan-2-ylamino]acetate (PubChem CID 22243033) has the molecular formula C20H24N4O8S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[[2-(3-methylsulfonyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]-propan-2-ylamino]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[[2-(3-methylsulfonyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 22243033 |
| Molecular Formula | C20H24N4O8S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[[2-(3-methylsulfonyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]-propan-2-ylamino]acetate |
| SMILES | CC(C)N(CC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)c1csc(N2CC(OS(C)(=O)=O)C2)n1 |
| InChI | InChI=1S/C20H24N4O8S2/c1-13(2)23(10-18(25)31-11-14-4-6-15(7-5-14)24(27)28)19(26)17-12-33-20(21-17)22-8-16(9-22)32-34(3,29)30/h4-7,12-13,16H,8-11H2,1-3H3 |
| InChIKey | ATXLDUOEVRBSQS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 149.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|