C35H43N5O5SSi — CID 173231792
2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[(4-nitrophenyl)methoxyamino]ethyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 173231792) has the molecular formula C35H43N5O5SSi and a molecular weight of 673.91 g/mol. Its IUPAC name is 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[(4-nitrophenyl)methoxyamino]ethyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[(4-nitrophenyl)methoxyamino]ethyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173231792 |
| Molecular Formula | C35H43N5O5SSi |
| Molecular Weight | 673.91 g/mol |
| Exact Mass | 673.28 |
| IUPAC Name | 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-N-[2-[(4-nitrophenyl)methoxyamino]ethyl]-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)N(CCNOCc1ccc([N+](=O)[O-])cc1)C(=O)c1csc(N2CC(C(C)(C)C)C2O[SiH](c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C35H43N5O5SSi/c1-25(2)38(21-20-36-44-23-26-16-18-27(19-17-26)40(42)43)32(41)31-24-46-34(37-31)39-22-30(35(3,4)5)33(39)45-47(28-12-8-6-9-13-28)29-14-10-7-11-15-29/h6-19,24-25,30,33,36,47H,20-23H2,1-5H3 |
| InChIKey | KBRHGOIUUZVPAP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.91 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|