C23H27N3O2SSi — CID 173183392
2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carboxamide (PubChem CID 173183392) has the molecular formula C23H27N3O2SSi and a molecular weight of 437.64 g/mol. Its IUPAC name is 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173183392 |
| Molecular Formula | C23H27N3O2SSi |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(C)C1CN(c2nc(C(N)=O)cs2)C1O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2SSi/c1-23(2,3)18-14-26(22-25-19(15-29-22)20(24)27)21(18)28-30(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15,18,21,30H,14H2,1-3H3,(H2,24,27) |
| InChIKey | FUYVBUSQJBPJQB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|