C20H24N4O2S — CID 56906611
2-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3-thiazole-4-carboxamide (PubChem CID 56906611) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 56906611 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[(2R,3R,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc([C@@H]2CN(c3nc(C(N)=O)cs3)[C@@H]3C4CCN(CC4)[C@@H]32)c1 |
| InChI | InChI=1S/C20H24N4O2S/c1-26-14-4-2-3-13(9-14)15-10-24(20-22-16(11-27-20)19(21)25)17-12-5-7-23(8-6-12)18(15)17/h2-4,9,11-12,15,17-18H,5-8,10H2,1H3,(H2,21,25)/t15-,17+,18+/m0/s1 |
| InChIKey | CKZRRDGSLXKHAB-CGTJXYLNSA-N |
| XLogP | 2.32 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |