C18H22N4OS — CID 56881934
2-[(2R,3R,6R)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3,4-thiadiazole (PubChem CID 56881934) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-[(2R,3R,6R)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3,4-thiadiazole.
| Compound Name | 2-[(2R,3R,6R)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 56881934 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[(2R,3R,6R)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-1,3,4-thiadiazole |
| SMILES | COc1ccc([C@@H]2CN(c3nncs3)[C@@H]3C4CCN(CC4)[C@@H]32)cc1 |
| InChI | InChI=1S/C18H22N4OS/c1-23-14-4-2-12(3-5-14)15-10-22(18-20-19-11-24-18)16-13-6-8-21(9-7-13)17(15)16/h2-5,11,13,15-17H,6-10H2,1H3/t15-,16+,17+/m0/s1 |
| InChIKey | IHKZINQSUWAZPC-GVDBMIGSSA-N |
| XLogP | 2.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |