C22H29N5O — CID 133127395
6-[(2S,3S,6S)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-N,N-dimethylpyrimidin-4-amine (PubChem CID 133127395) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 6-[(2S,3S,6S)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-N,N-dimethylpyrimidin-4-amine.
| Compound Name | 6-[(2S,3S,6S)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-N,N-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133127395 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 6-[(2S,3S,6S)-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-N,N-dimethylpyrimidin-4-amine |
| SMILES | COc1ccc([C@H]2CN(c3cc(N(C)C)ncn3)[C@H]3C4CCN(CC4)[C@@H]23)cc1 |
| InChI | InChI=1S/C22H29N5O/c1-25(2)19-12-20(24-14-23-19)27-13-18(15-4-6-17(28-3)7-5-15)22-21(27)16-8-10-26(22)11-9-16/h4-7,12,14,16,18,21-22H,8-11,13H2,1-3H3/t18-,21+,22+/m1/s1 |
| InChIKey | NKDALHIPHGCUCB-COPCDDAFSA-N |
| XLogP | 2.62 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |