C23H32N4O — CID 133125344
(2S,3S,6S)-3-(4-methoxyphenyl)-5-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,5-diazatricyclo[5.2.2.02,6]undecane (PubChem CID 133125344) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is (2S,3S,6S)-3-(4-methoxyphenyl)-5-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,5-diazatricyclo[5.2.2.02,6]undecane.
| Compound Name | (2S,3S,6S)-3-(4-methoxyphenyl)-5-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,5-diazatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 133125344 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (2S,3S,6S)-3-(4-methoxyphenyl)-5-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,5-diazatricyclo[5.2.2.02,6]undecane |
| SMILES | COc1ccc([C@H]2CN(Cc3c(C)nn(C)c3C)[C@H]3C4CCN(CC4)[C@@H]23)cc1 |
| InChI | InChI=1S/C23H32N4O/c1-15-20(16(2)25(3)24-15)13-27-14-21(17-5-7-19(28-4)8-6-17)23-22(27)18-9-11-26(23)12-10-18/h5-8,18,21-23H,9-14H2,1-4H3/t21-,22+,23+/m1/s1 |
| InChIKey | FGOISCXLGPAPLB-VJBWXMMDSA-N |
| XLogP | 3.11 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |