C21H25N3O2S — CID 56917874
[(2R,3S,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 56917874) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is [(2R,3S,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(2R,3S,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 56917874 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [(2R,3S,6R)-3-(3-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | COc1cccc([C@H]2CN(C(=O)c3csc(C)n3)[C@@H]3C4CCN(CC4)[C@H]23)c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-13-22-18(12-27-13)21(25)24-11-17(15-4-3-5-16(10-15)26-2)20-19(24)14-6-8-23(20)9-7-14/h3-5,10,12,14,17,19-20H,6-9,11H2,1-2H3/t17-,19-,20-/m1/s1 |
| InChIKey | UIBIOCJHMRWMNF-MISYRCLQSA-N |
| XLogP | 3.16 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |