C33H37N5O6SSi — CID 173183411
(4-nitrophenyl)methyl N-[2-[[2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 173183411) has the molecular formula C33H37N5O6SSi and a molecular weight of 659.84 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[2-[[2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[2-[[2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 173183411 |
| Molecular Formula | C33H37N5O6SSi |
| Molecular Weight | 659.84 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | (4-nitrophenyl)methyl N-[2-[[2-(3-tert-butyl-2-diphenylsilyloxyazetidin-1-yl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)C1CN(c2nc(C(=O)NCCNC(=O)OCc3ccc([N+](=O)[O-])cc3)cs2)C1O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37N5O6SSi/c1-33(2,3)27-20-37(30(27)44-46(25-10-6-4-7-11-25)26-12-8-5-9-13-26)31-36-28(22-45-31)29(39)34-18-19-35-32(40)43-21-23-14-16-24(17-15-23)38(41)42/h4-17,22,27,30,46H,18-21H2,1-3H3,(H,34,39)(H,35,40) |
| InChIKey | CPBWPVFDMUNJIQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|