C26H25N5O9S2 — CID 19884072
(4-nitrophenyl)methyl 4-acetylsulfanyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carboxylate (PubChem CID 19884072) has the molecular formula C26H25N5O9S2 and a molecular weight of 615.65 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19884072 |
| Molecular Formula | C26H25N5O9S2 |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)SC1CC(c2csc(CNC(=O)OCc3ccc([N+](=O)[O-])cc3)n2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C26H25N5O9S2/c1-16(32)42-21-10-23(29(12-21)26(34)40-14-18-4-8-20(9-5-18)31(37)38)22-15-41-24(28-22)11-27-25(33)39-13-17-2-6-19(7-3-17)30(35)36/h2-9,15,21,23H,10-14H2,1H3,(H,27,33) |
| InChIKey | RCKFYGGDJTVJAG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 184.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|