C18H18N6O5S2 — CID 18638814
(4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(azidomethyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 18638814) has the molecular formula C18H18N6O5S2 and a molecular weight of 462.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(azidomethyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(azidomethyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18638814 |
| Molecular Formula | C18H18N6O5S2 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-acetylsulfanyl-2-[4-(azidomethyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1C[C@@H](c2nc(CN=[N+]=[N-])cs2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H18N6O5S2/c1-11(25)31-15-6-16(17-21-13(10-30-17)7-20-22-19)23(8-15)18(26)29-9-12-2-4-14(5-3-12)24(27)28/h2-5,10,15-16H,6-9H2,1H3/t15-,16-/m0/s1 |
| InChIKey | ZJLQDOSUETVRKS-HOTGVXAUSA-N |
| XLogP | 4.59 |
| TPSA | 151.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|