C26H25N5O8S2 — CID 88652993
S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carbothioate (PubChem CID 88652993) has the molecular formula C26H25N5O8S2 and a molecular weight of 599.65 g/mol. Its IUPAC name is S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carbothioate.
| Compound Name | S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carbothioate |
|---|---|
| PubChem CID | 88652993 |
| Molecular Formula | C26H25N5O8S2 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,3-thiazol-4-yl]pyrrolidine-1-carbothioate |
| SMILES | CC(=O)[C@H]1C[C@@H](c2csc(CNC(=O)OCc3ccc([N+](=O)[O-])cc3)n2)N(C(=O)SCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C26H25N5O8S2/c1-16(32)19-10-23(29(12-19)26(34)41-14-18-4-8-21(9-5-18)31(37)38)22-15-40-24(28-22)11-27-25(33)39-13-17-2-6-20(7-3-17)30(35)36/h2-9,15,19,23H,10-14H2,1H3,(H,27,33)/t19-,23-/m0/s1 |
| InChIKey | UZUSUSUVXMZMJV-CVDCTZTESA-N |
| XLogP | 5.39 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|