C16H17N5O5S — CID 57224529
S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-(3-amino-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carbothioate (PubChem CID 57224529) has the molecular formula C16H17N5O5S and a molecular weight of 391.41 g/mol. Its IUPAC name is S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-(3-amino-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carbothioate.
| Compound Name | S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-(3-amino-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carbothioate |
|---|---|
| PubChem CID | 57224529 |
| Molecular Formula | C16H17N5O5S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | S-[(4-nitrophenyl)methyl] (2S,4S)-4-acetyl-2-(3-amino-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carbothioate |
| SMILES | CC(=O)[C@H]1C[C@@H](c2nc(N)no2)N(C(=O)SCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C16H17N5O5S/c1-9(22)11-6-13(14-18-15(17)19-26-14)20(7-11)16(23)27-8-10-2-4-12(5-3-10)21(24)25/h2-5,11,13H,6-8H2,1H3,(H2,17,19)/t11-,13-/m0/s1 |
| InChIKey | HXCNSOLBVFEQSI-AAEUAGOBSA-N |
| XLogP | 2.57 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|