C20H20N4O5 — CID 26744158
(3R,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-[(4-nitrophenyl)methyl]pyrrolidin-3-ol (PubChem CID 26744158) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is (3R,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-[(4-nitrophenyl)methyl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-[(4-nitrophenyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 26744158 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (3R,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-[(4-nitrophenyl)methyl]pyrrolidin-3-ol |
| SMILES | COc1ccc(-c2noc([C@@H]3C[C@@H](O)CN3Cc3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C20H20N4O5/c1-28-17-8-4-14(5-9-17)19-21-20(29-22-19)18-10-16(25)12-23(18)11-13-2-6-15(7-3-13)24(26)27/h2-9,16,18,25H,10-12H2,1H3/t16-,18+/m1/s1 |
| InChIKey | VYLHEHMXUIFRGV-AEFFLSMTSA-N |
| XLogP | 2.96 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|