C11H13N3O2S — CID 47139994
(4-nitrophenyl)methyl N'-cyclopropylcarbamimidothioate (PubChem CID 47139994) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N'-cyclopropylcarbamimidothioate.
| Compound Name | (4-nitrophenyl)methyl N'-cyclopropylcarbamimidothioate |
|---|---|
| PubChem CID | 47139994 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (4-nitrophenyl)methyl N'-cyclopropylcarbamimidothioate |
| SMILES | N/C(=N\C1CC1)SCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13N3O2S/c12-11(13-9-3-4-9)17-7-8-1-5-10(6-2-8)14(15)16/h1-2,5-6,9H,3-4,7H2,(H2,12,13) |
| InChIKey | SONLFNOCPMICGB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|