About (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate
(4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate (PubChem CID 15397959) has the molecular formula C14H12N4O4S2
and a molecular weight of 364.41 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate |
| PubChem CID | 15397959 |
| Molecular Formula | C14H12N4O4S2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate |
| SMILES | O=[N+]([O-])c1ccc(CSC(=S)NNc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H12N4O4S2/c19-17(20)12-5-1-10(2-6-12)9-24-14(23)16-15-11-3-7-13(8-4-11)18(21)22/h1-8,15H,9H2,(H,16,23) |
| InChIKey | SKWLMPLIPVBBKA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate?
The IUPAC name of (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate (CID 15397959) is (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate.
What is the SMILES notation for (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate?
The canonical SMILES for (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate is O=[N+]([O-])c1ccc(CSC(=S)NNc2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate?
The InChIKey is SKWLMPLIPVBBKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O4S2/c19-17(20)12-5-1-10(2-6-12)9-24-14(23)16-15-11-3-7-13(8-4-11)18(21)22/h1-8,15H,9H2,(H,16,23).
What are the key properties of (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate?
(4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate has a molecular weight of 364.41 g/mol, XLogP of 3.64, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl N-(4-nitroanilino)carbamodithioate is sourced from PubChem (CID 15397959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).