C19H21N5O2S — CID 168612099
benzyl N'-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]carbamimidothioate (PubChem CID 168612099) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is benzyl N'-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612099 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | benzyl N'-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc([N+](=O)[O-])ccc1N1CCCC1)SCc1ccccc1 |
| InChI | InChI=1S/C19H21N5O2S/c20-19(27-14-15-6-2-1-3-7-15)22-21-13-16-12-17(24(25)26)8-9-18(16)23-10-4-5-11-23/h1-3,6-9,12-13H,4-5,10-11,14H2,(H2,20,22) |
| InChIKey | SZYXBIJFBKEOKV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|