C11H11N4O3S- — CID 7398426
2-[(Z)-[(E)-[amino(prop-2-enylsulfanyl)methylidene]hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 7398426) has the molecular formula C11H11N4O3S- and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[(Z)-[(E)-[amino(prop-2-enylsulfanyl)methylidene]hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[(E)-[amino(prop-2-enylsulfanyl)methylidene]hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7398426 |
| Molecular Formula | C11H11N4O3S- |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-[(Z)-[(E)-[amino(prop-2-enylsulfanyl)methylidene]hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | C=CCS/C(N)=N/N=C\c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C11H12N4O3S/c1-2-5-19-11(12)14-13-7-8-6-9(15(17)18)3-4-10(8)16/h2-4,6-7,16H,1,5H2,(H2,12,14)/p-1/b13-7- |
| InChIKey | BDQUYKZUEMHXNA-QPEQYQDCSA-M |
| XLogP | 1.24 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|