C10H7N2O3- — CID 7608898
4-nitro-2-(prop-2-ynyliminomethyl)phenolate (PubChem CID 7608898) has the molecular formula C10H7N2O3- and a molecular weight of 203.18 g/mol. Its IUPAC name is 4-nitro-2-(prop-2-ynyliminomethyl)phenolate.
| Compound Name | 4-nitro-2-(prop-2-ynyliminomethyl)phenolate |
|---|---|
| PubChem CID | 7608898 |
| Molecular Formula | C10H7N2O3- |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 4-nitro-2-(prop-2-ynyliminomethyl)phenolate |
| SMILES | C#CC/N=C/c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C10H8N2O3/c1-2-5-11-7-8-6-9(12(14)15)3-4-10(8)13/h1,3-4,6-7,13H,5H2/p-1/b11-7+ |
| InChIKey | UQTMJFNIIVFEQE-YRNVUSSQSA-M |
| XLogP | 0.72 |
| TPSA | 78.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|