C11H13N2O4- — CID 7300824
2-[[(2S)-1-hydroxybutan-2-yl]iminomethyl]-4-nitrophenolate (PubChem CID 7300824) has the molecular formula C11H13N2O4- and a molecular weight of 237.24 g/mol. Its IUPAC name is 2-[[(2S)-1-hydroxybutan-2-yl]iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[[(2S)-1-hydroxybutan-2-yl]iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7300824 |
| Molecular Formula | C11H13N2O4- |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-[[(2S)-1-hydroxybutan-2-yl]iminomethyl]-4-nitrophenolate |
| SMILES | CC[C@@H](CO)/N=C/c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C11H14N2O4/c1-2-9(7-14)12-6-8-5-10(13(16)17)3-4-11(8)15/h3-6,9,14-15H,2,7H2,1H3/p-1/b12-6+/t9-/m0/s1 |
| InChIKey | RGUNZRKDOFNFNR-DAVUEJTQSA-M |
| XLogP | 0.86 |
| TPSA | 98.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|