C15H14N3O5S- — CID 7609060
4-nitro-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]iminomethyl]phenolate (PubChem CID 7609060) has the molecular formula C15H14N3O5S- and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-nitro-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]iminomethyl]phenolate.
| Compound Name | 4-nitro-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]iminomethyl]phenolate |
|---|---|
| PubChem CID | 7609060 |
| Molecular Formula | C15H14N3O5S- |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-nitro-2-[[(1R)-1-(4-sulfamoylphenyl)ethyl]iminomethyl]phenolate |
| SMILES | C[C@@H](/N=C/c1cc([N+](=O)[O-])ccc1[O-])c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H15N3O5S/c1-10(11-2-5-14(6-3-11)24(16,22)23)17-9-12-8-13(18(20)21)4-7-15(12)19/h2-10,19H,1H3,(H2,16,22,23)/p-1/b17-9+/t10-/m1/s1 |
| InChIKey | ULZRFPRDLORYKT-IYPWXLATSA-M |
| XLogP | 1.50 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|