C14H17N2O5- — CID 7608833
2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminomethyl]-4-nitrophenolate (PubChem CID 7608833) has the molecular formula C14H17N2O5- and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7608833 |
| Molecular Formula | C14H17N2O5- |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminomethyl]-4-nitrophenolate |
| SMILES | COC(=O)[C@@H](CC(C)C)/N=C/c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C14H18N2O5/c1-9(2)6-12(14(18)21-3)15-8-10-7-11(16(19)20)4-5-13(10)17/h4-5,7-9,12,17H,6H2,1-3H3/p-1/b15-8+/t12-/m1/s1 |
| InChIKey | BQXMMZHGHVOWTB-AZZDOICSSA-M |
| XLogP | 1.67 |
| TPSA | 104.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|