C14H12N3O5S- — CID 7637601
2-[(4-methyl-3-sulfamoylphenyl)iminomethyl]-4-nitrophenolate (PubChem CID 7637601) has the molecular formula C14H12N3O5S- and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[(4-methyl-3-sulfamoylphenyl)iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[(4-methyl-3-sulfamoylphenyl)iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7637601 |
| Molecular Formula | C14H12N3O5S- |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-[(4-methyl-3-sulfamoylphenyl)iminomethyl]-4-nitrophenolate |
| SMILES | Cc1ccc(/N=C/c2cc([N+](=O)[O-])ccc2[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H13N3O5S/c1-9-2-3-11(7-14(9)23(15,21)22)16-8-10-6-12(17(19)20)4-5-13(10)18/h2-8,18H,1H3,(H2,15,21,22)/p-1/b16-8+ |
| InChIKey | AFCXQDATPSRKKQ-LZYBPNLTSA-M |
| XLogP | 1.37 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|