C17H18ClN3O5S — CID 135596128
2-chloro-N,N-diethyl-5-[(2-hydroxy-5-nitrophenyl)methylideneamino]benzenesulfonamide (PubChem CID 135596128) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-5-[(2-hydroxy-5-nitrophenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 2-chloro-N,N-diethyl-5-[(2-hydroxy-5-nitrophenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135596128 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2-chloro-N,N-diethyl-5-[(2-hydroxy-5-nitrophenyl)methylideneamino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(/N=C/c2cc([N+](=O)[O-])ccc2O)ccc1Cl |
| InChI | InChI=1S/C17H18ClN3O5S/c1-3-20(4-2)27(25,26)17-10-13(5-7-15(17)18)19-11-12-9-14(21(23)24)6-8-16(12)22/h5-11,22H,3-4H2,1-2H3/b19-11+ |
| InChIKey | KTXWYLGJVZJXTC-YBFXNURJSA-N |
| XLogP | 3.73 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|