C14H12ClN5O4S — CID 3760612
2-[4-[(2-chloro-5-nitrophenyl)methylideneamino]phenyl]sulfonylguanidine (PubChem CID 3760612) has the molecular formula C14H12ClN5O4S and a molecular weight of 381.80 g/mol. Its IUPAC name is 2-[4-[(2-chloro-5-nitrophenyl)methylideneamino]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[(2-chloro-5-nitrophenyl)methylideneamino]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 3760612 |
| Molecular Formula | C14H12ClN5O4S |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 2-[4-[(2-chloro-5-nitrophenyl)methylideneamino]phenyl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(/N=C/c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C14H12ClN5O4S/c15-13-6-3-11(20(21)22)7-9(13)8-18-10-1-4-12(5-2-10)25(23,24)19-14(16)17/h1-8H,(H4,16,17,19)/b18-8+ |
| InChIKey | RNTMRTYJILJULF-QGMBQPNBSA-N |
| XLogP | 1.96 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|