C15H14ClN3O2 — CID 126104463
4-[(2-chloro-5-nitrophenyl)methylideneamino]-N,N-dimethylaniline (PubChem CID 126104463) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-[(2-chloro-5-nitrophenyl)methylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[(2-chloro-5-nitrophenyl)methylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 126104463 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-[(2-chloro-5-nitrophenyl)methylideneamino]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=C/c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C15H14ClN3O2/c1-18(2)13-5-3-12(4-6-13)17-10-11-9-14(19(20)21)7-8-15(11)16/h3-10H,1-2H3/b17-10+ |
| InChIKey | NKHSJFHKCZMFJQ-LICLKQGHSA-N |
| XLogP | 4.06 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|