C14H12Br2N4O3S — CID 4572847
2-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylguanidine (PubChem CID 4572847) has the molecular formula C14H12Br2N4O3S and a molecular weight of 476.15 g/mol. Its IUPAC name is 2-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 4572847 |
| Molecular Formula | C14H12Br2N4O3S |
| Molecular Weight | 476.15 g/mol |
| Exact Mass | 473.90 |
| IUPAC Name | 2-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C14H12Br2N4O3S/c15-9-5-8(13(21)12(16)6-9)7-19-10-1-3-11(4-2-10)24(22,23)20-14(17)18/h1-7,21H,(H4,17,18,20)/b19-7+ |
| InChIKey | ACDOWVVVIMVICL-FBCYGCLPSA-N |
| XLogP | 2.63 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|