C13H8Br2N2O3 — CID 1286595
2,4-dibromo-6-[(3-nitrophenyl)iminomethyl]phenol (PubChem CID 1286595) has the molecular formula C13H8Br2N2O3 and a molecular weight of 400.03 g/mol. Its IUPAC name is 2,4-dibromo-6-[(3-nitrophenyl)iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(3-nitrophenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 1286595 |
| Molecular Formula | C13H8Br2N2O3 |
| Molecular Weight | 400.03 g/mol |
| Exact Mass | 397.89 |
| IUPAC Name | 2,4-dibromo-6-[(3-nitrophenyl)iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1cccc(/N=C/c2cc(Br)cc(Br)c2O)c1 |
| InChI | InChI=1S/C13H8Br2N2O3/c14-9-4-8(13(18)12(15)5-9)7-16-10-2-1-3-11(6-10)17(19)20/h1-7,18H/b16-7+ |
| InChIKey | STLNRTRPBCQCLO-FRKPEAEDSA-N |
| XLogP | 4.58 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.03 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|