C23H15Br2N5O3 — CID 136861896
2,4-dibromo-6-[[1-[(Z)-(3-nitrophenyl)methylideneamino]-4-phenylimidazol-2-yl]iminomethyl]phenol (PubChem CID 136861896) has the molecular formula C23H15Br2N5O3 and a molecular weight of 569.21 g/mol. Its IUPAC name is 2,4-dibromo-6-[[1-[(Z)-(3-nitrophenyl)methylideneamino]-4-phenylimidazol-2-yl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[[1-[(Z)-(3-nitrophenyl)methylideneamino]-4-phenylimidazol-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136861896 |
| Molecular Formula | C23H15Br2N5O3 |
| Molecular Weight | 569.21 g/mol |
| Exact Mass | 566.95 |
| IUPAC Name | 2,4-dibromo-6-[[1-[(Z)-(3-nitrophenyl)methylideneamino]-4-phenylimidazol-2-yl]iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N\n2cc(-c3ccccc3)nc2N=Cc2cc(Br)cc(Br)c2O)c1 |
| InChI | InChI=1S/C23H15Br2N5O3/c24-18-10-17(22(31)20(25)11-18)13-26-23-28-21(16-6-2-1-3-7-16)14-29(23)27-12-15-5-4-8-19(9-15)30(32)33/h1-14,31H/b26-13?,27-12- |
| InChIKey | XSLBTOJNYIJBCL-LUPCTRIOSA-N |
| XLogP | 6.32 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.21 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|