C18H20N3O3- — CID 7505762
2-[3-(N-ethylanilino)propyliminomethyl]-4-nitrophenolate (PubChem CID 7505762) has the molecular formula C18H20N3O3- and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[3-(N-ethylanilino)propyliminomethyl]-4-nitrophenolate.
| Compound Name | 2-[3-(N-ethylanilino)propyliminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7505762 |
| Molecular Formula | C18H20N3O3- |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[3-(N-ethylanilino)propyliminomethyl]-4-nitrophenolate |
| SMILES | CCN(CCC/N=C/c1cc([N+](=O)[O-])ccc1[O-])c1ccccc1 |
| InChI | InChI=1S/C18H21N3O3/c1-2-20(16-7-4-3-5-8-16)12-6-11-19-14-15-13-17(21(23)24)9-10-18(15)22/h3-5,7-10,13-14,22H,2,6,11-12H2,1H3/p-1/b19-14+ |
| InChIKey | ZUMFRROBDLMQFV-XMHGGMMESA-M |
| XLogP | 3.00 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|