C15H18N3O5- — CID 7611658
2-[(1-ethoxycarbonylpiperidin-4-yl)iminomethyl]-4-nitrophenolate (PubChem CID 7611658) has the molecular formula C15H18N3O5- and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-[(1-ethoxycarbonylpiperidin-4-yl)iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[(1-ethoxycarbonylpiperidin-4-yl)iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7611658 |
| Molecular Formula | C15H18N3O5- |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[(1-ethoxycarbonylpiperidin-4-yl)iminomethyl]-4-nitrophenolate |
| SMILES | CCOC(=O)N1CCC(/N=C/c2cc([N+](=O)[O-])ccc2[O-])CC1 |
| InChI | InChI=1S/C15H19N3O5/c1-2-23-15(20)17-7-5-12(6-8-17)16-10-11-9-13(18(21)22)3-4-14(11)19/h3-4,9-10,12,19H,2,5-8H2,1H3/p-1/b16-10+ |
| InChIKey | VHFFIJSAWQMRJU-MHWRWJLKSA-M |
| XLogP | 1.71 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|