C22H25N3O4 — CID 10500896
ethyl 4-(14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidine-1-carboxylate (PubChem CID 10500896) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 4-(14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10500896 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | ethyl 4-(14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C2c3cc([N+](=O)[O-])ccc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C22H25N3O4/c1-2-29-22(26)24-12-9-16(10-13-24)20-19-14-18(25(27)28)8-7-15(19)5-6-17-4-3-11-23-21(17)20/h3-4,7-8,11,14,16,20H,2,5-6,9-10,12-13H2,1H3 |
| InChIKey | OEFWIKWVNWGCHC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|