C24H29N7O5 — CID 42803565
ethyl 4-(8-nitro-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl)piperazine-1-carboxylate (PubChem CID 42803565) has the molecular formula C24H29N7O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is ethyl 4-(8-nitro-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(8-nitro-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42803565 |
| Molecular Formula | C24H29N7O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | ethyl 4-(8-nitro-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2Cc3cc([N+](=O)[O-])ccc3N3CCN(c4ncccn4)CC23)CC1 |
| InChI | InChI=1S/C24H29N7O5/c1-2-36-24(33)28-10-8-27(9-11-28)22(32)19-15-17-14-18(31(34)35)4-5-20(17)30-13-12-29(16-21(19)30)23-25-6-3-7-26-23/h3-7,14,19,21H,2,8-13,15-16H2,1H3 |
| InChIKey | OCJFPNPCOJDPNU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 125.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|