C26H30ClN5O5 — CID 93123205
ethyl 4-[(4aS,5R)-3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate (PubChem CID 93123205) has the molecular formula C26H30ClN5O5 and a molecular weight of 528.01 g/mol. Its IUPAC name is ethyl 4-[(4aS,5R)-3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(4aS,5R)-3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 93123205 |
| Molecular Formula | C26H30ClN5O5 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | ethyl 4-[(4aS,5R)-3-(2-chlorophenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@@H]2Cc3cc([N+](=O)[O-])ccc3N3CCN(c4ccccc4Cl)C[C@H]23)CC1 |
| InChI | InChI=1S/C26H30ClN5O5/c1-2-37-26(34)29-11-9-28(10-12-29)25(33)20-16-18-15-19(32(35)36)7-8-22(18)31-14-13-30(17-24(20)31)23-6-4-3-5-21(23)27/h3-8,15,20,24H,2,9-14,16-17H2,1H3/t20-,24-/m1/s1 |
| InChIKey | QYFXLUYOINRYBS-HYBUGGRVSA-N |
| XLogP | 3.42 |
| TPSA | 99.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|