C27H33N5O5 — CID 93123315
ethyl 4-[(4aS,5S)-3-(4-methylphenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate (PubChem CID 93123315) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is ethyl 4-[(4aS,5S)-3-(4-methylphenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(4aS,5S)-3-(4-methylphenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 93123315 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | ethyl 4-[(4aS,5S)-3-(4-methylphenyl)-8-nitro-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@H]2Cc3cc([N+](=O)[O-])ccc3N3CCN(c4ccc(C)cc4)C[C@H]23)CC1 |
| InChI | InChI=1S/C27H33N5O5/c1-3-37-27(34)29-12-10-28(11-13-29)26(33)23-17-20-16-22(32(35)36)8-9-24(20)31-15-14-30(18-25(23)31)21-6-4-19(2)5-7-21/h4-9,16,23,25H,3,10-15,17-18H2,1-2H3/t23-,25+/m0/s1 |
| InChIKey | INYNHQXJWSOGMX-UKILVPOCSA-N |
| XLogP | 3.07 |
| TPSA | 99.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|