C30H30F3N5O3 — CID 42803607
(8-nitro-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 42803607) has the molecular formula C30H30F3N5O3 and a molecular weight of 565.60 g/mol. Its IUPAC name is (8-nitro-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (8-nitro-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42803607 |
| Molecular Formula | C30H30F3N5O3 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | (8-nitro-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1Cc2cc([N+](=O)[O-])ccc2N2CCN(c3ccccc3)CC12)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C30H30F3N5O3/c31-30(32,33)22-5-4-8-24(19-22)34-11-13-35(14-12-34)29(39)26-18-21-17-25(38(40)41)9-10-27(21)37-16-15-36(20-28(26)37)23-6-2-1-3-7-23/h1-10,17,19,26,28H,11-16,18,20H2 |
| InChIKey | CKJAMPGZGNMENQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 73.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|