C31H33F3N4O — CID 98148734
[(4aR,5S)-3-(4-methylphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 98148734) has the molecular formula C31H33F3N4O and a molecular weight of 534.63 g/mol. Its IUPAC name is [(4aR,5S)-3-(4-methylphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [(4aR,5S)-3-(4-methylphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 98148734 |
| Molecular Formula | C31H33F3N4O |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | [(4aR,5S)-3-(4-methylphenyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN3c4ccccc4C[C@H](C(=O)N4CCN(c5cccc(C(F)(F)F)c5)CC4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C31H33F3N4O/c1-22-9-11-25(12-10-22)37-17-18-38-28-8-3-2-5-23(28)19-27(29(38)21-37)30(39)36-15-13-35(14-16-36)26-7-4-6-24(20-26)31(32,33)34/h2-12,20,27,29H,13-19,21H2,1H3/t27-,29-/m0/s1 |
| InChIKey | DRWNWVPSHYNIMJ-YTMVLYRLSA-N |
| XLogP | 5.23 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|