C24H29N3O2 — CID 99730054
[(4aS,5S)-9-methoxy-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 99730054) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is [(4aS,5S)-9-methoxy-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(4aS,5S)-9-methoxy-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 99730054 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | [(4aS,5S)-9-methoxy-3-phenyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1ccc2c(c1)N1CCN(c3ccccc3)C[C@@H]1[C@@H](C(=O)N1CCCC1)C2 |
| InChI | InChI=1S/C24H29N3O2/c1-29-20-10-9-18-15-21(24(28)25-11-5-6-12-25)23-17-26(19-7-3-2-4-8-19)13-14-27(23)22(18)16-20/h2-4,7-10,16,21,23H,5-6,11-15,17H2,1H3/t21-,23+/m0/s1 |
| InChIKey | QMLUULNDLYVCDF-JTHBVZDNSA-N |
| XLogP | 3.19 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |