C26H29N3O2S — CID 100898869
(4aR,5R)-9-methoxy-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 100898869) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is (4aR,5R)-9-methoxy-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-9-methoxy-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 100898869 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (4aR,5R)-9-methoxy-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(c3ccccc3)C[C@H]1[C@H](C(=O)NCCc1cccs1)C2 |
| InChI | InChI=1S/C26H29N3O2S/c1-31-21-10-9-19-16-23(26(30)27-12-11-22-8-5-15-32-22)25-18-28(20-6-3-2-4-7-20)13-14-29(25)24(19)17-21/h2-10,15,17,23,25H,11-14,16,18H2,1H3,(H,27,30)/t23-,25+/m1/s1 |
| InChIKey | RNPYIIHNVGVQTG-NOZRDPDXSA-N |
| XLogP | 3.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |