C26H28FN3O2S — CID 93125483
(4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93125483) has the molecular formula C26H28FN3O2S and a molecular weight of 465.59 g/mol. Its IUPAC name is (4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93125483 |
| Molecular Formula | C26H28FN3O2S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(c3ccc(F)cc3)C[C@@H]1[C@H](C(=O)NCCc1cccs1)C2 |
| InChI | InChI=1S/C26H28FN3O2S/c1-32-21-9-4-18-15-23(26(31)28-11-10-22-3-2-14-33-22)25-17-29(12-13-30(25)24(18)16-21)20-7-5-19(27)6-8-20/h2-9,14,16,23,25H,10-13,15,17H2,1H3,(H,28,31)/t23-,25-/m1/s1 |
| InChIKey | HDLXJXMXOMTMQA-ILBGXUMGSA-N |
| XLogP | 4.12 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |