C27H35FN4O2 — CID 93125486
(4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93125486) has the molecular formula C27H35FN4O2 and a molecular weight of 466.60 g/mol. Its IUPAC name is (4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93125486 |
| Molecular Formula | C27H35FN4O2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (4aS,5R)-3-(4-fluorophenyl)-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(c3ccc(F)cc3)C[C@@H]1[C@H](C(=O)NCCN1CCCCC1)C2 |
| InChI | InChI=1S/C27H35FN4O2/c1-34-23-10-5-20-17-24(27(33)29-11-14-30-12-3-2-4-13-30)26-19-31(15-16-32(26)25(20)18-23)22-8-6-21(28)7-9-22/h5-10,18,24,26H,2-4,11-17,19H2,1H3,(H,29,33)/t24-,26-/m1/s1 |
| InChIKey | MCHQBCMUEZVFEE-AOYPEHQESA-N |
| XLogP | 3.30 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |