C28H37ClN4O2 — CID 100898893
(4aR,5S)-3-[(4-chlorophenyl)methyl]-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 100898893) has the molecular formula C28H37ClN4O2 and a molecular weight of 497.08 g/mol. Its IUPAC name is (4aR,5S)-3-[(4-chlorophenyl)methyl]-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-[(4-chlorophenyl)methyl]-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 100898893 |
| Molecular Formula | C28H37ClN4O2 |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (4aR,5S)-3-[(4-chlorophenyl)methyl]-9-methoxy-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(Cc3ccc(Cl)cc3)C[C@H]1[C@@H](C(=O)NCCN1CCCCC1)C2 |
| InChI | InChI=1S/C28H37ClN4O2/c1-35-24-10-7-22-17-25(28(34)30-11-14-31-12-3-2-4-13-31)27-20-32(15-16-33(27)26(22)18-24)19-21-5-8-23(29)9-6-21/h5-10,18,25,27H,2-4,11-17,19-20H2,1H3,(H,30,34)/t25-,27-/m0/s1 |
| InChIKey | BXPSRSXZHBZHGX-BDYUSTAISA-N |
| XLogP | 3.81 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |