C27H41N5O4 — CID 100898948
(4aR,5R)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 100898948) has the molecular formula C27H41N5O4 and a molecular weight of 499.66 g/mol. Its IUPAC name is (4aR,5R)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 100898948 |
| Molecular Formula | C27H41N5O4 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | (4aR,5R)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(2-piperidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(CC(=O)N3CCOCC3)C[C@H]1[C@H](C(=O)NCCN1CCCCC1)C2 |
| InChI | InChI=1S/C27H41N5O4/c1-35-22-6-5-21-17-23(27(34)28-7-10-29-8-3-2-4-9-29)25-19-30(11-12-32(25)24(21)18-22)20-26(33)31-13-15-36-16-14-31/h5-6,18,23,25H,2-4,7-17,19-20H2,1H3,(H,28,34)/t23-,25+/m1/s1 |
| InChIKey | IXRGIGJVJCTQSA-NOZRDPDXSA-N |
| XLogP | 0.82 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |