C26H33N5O4 — CID 100897843
(4aR,5S)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(pyridin-4-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 100897843) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is (4aR,5S)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(pyridin-4-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(pyridin-4-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 100897843 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (4aR,5S)-9-methoxy-3-(2-morpholin-4-yl-2-oxoethyl)-N-(pyridin-4-ylmethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(CC(=O)N3CCOCC3)C[C@H]1[C@@H](C(=O)NCc1ccncc1)C2 |
| InChI | InChI=1S/C26H33N5O4/c1-34-21-3-2-20-14-22(26(33)28-16-19-4-6-27-7-5-19)24-17-29(8-9-31(24)23(20)15-21)18-25(32)30-10-12-35-13-11-30/h2-7,15,22,24H,8-14,16-18H2,1H3,(H,28,33)/t22-,24-/m0/s1 |
| InChIKey | FWLXQHQEXDEWHO-UPVQGACJSA-N |
| XLogP | 0.93 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |