C25H36N4O3 — CID 93123087
(4aR,5S)-N-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93123087) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is (4aR,5S)-N-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-N-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123087 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (4aR,5S)-N-cyclohexyl-3-(2-morpholin-4-yl-2-oxoethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@H]1Cc2ccccc2N2CCN(CC(=O)N3CCOCC3)C[C@@H]12 |
| InChI | InChI=1S/C25H36N4O3/c30-24(28-12-14-32-15-13-28)18-27-10-11-29-22-9-5-4-6-19(22)16-21(23(29)17-27)25(31)26-20-7-2-1-3-8-20/h4-6,9,20-21,23H,1-3,7-8,10-18H2,(H,26,31)/t21-,23-/m0/s1 |
| InChIKey | GNGSQQRDFVJLAD-GMAHTHKFSA-N |
| XLogP | 1.66 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |