C24H33F3N4O3 — CID 42801113
N-butan-2-yl-3-(2-morpholin-4-yl-2-oxoethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42801113) has the molecular formula C24H33F3N4O3 and a molecular weight of 482.55 g/mol. Its IUPAC name is N-butan-2-yl-3-(2-morpholin-4-yl-2-oxoethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | N-butan-2-yl-3-(2-morpholin-4-yl-2-oxoethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42801113 |
| Molecular Formula | C24H33F3N4O3 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-butan-2-yl-3-(2-morpholin-4-yl-2-oxoethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CCC(C)NC(=O)C1Cc2cc(C(F)(F)F)ccc2N2CCN(CC(=O)N3CCOCC3)CC12 |
| InChI | InChI=1S/C24H33F3N4O3/c1-3-16(2)28-23(33)19-13-17-12-18(24(25,26)27)4-5-20(17)31-7-6-29(14-21(19)31)15-22(32)30-8-10-34-11-9-30/h4-5,12,16,19,21H,3,6-11,13-15H2,1-2H3,(H,28,33) |
| InChIKey | WVZPCMYIKSZUHH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |