C24H27F4N3O — CID 93119363
(4aS,5R)-N-[(2S)-butan-2-yl]-3-(4-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93119363) has the molecular formula C24H27F4N3O and a molecular weight of 449.49 g/mol. Its IUPAC name is (4aS,5R)-N-[(2S)-butan-2-yl]-3-(4-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-[(2S)-butan-2-yl]-3-(4-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93119363 |
| Molecular Formula | C24H27F4N3O |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | (4aS,5R)-N-[(2S)-butan-2-yl]-3-(4-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC[C@H](C)NC(=O)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(c3ccc(F)cc3)C[C@H]12 |
| InChI | InChI=1S/C24H27F4N3O/c1-3-15(2)29-23(32)20-13-16-12-17(24(26,27)28)4-9-21(16)31-11-10-30(14-22(20)31)19-7-5-18(25)6-8-19/h4-9,12,15,20,22H,3,10-11,13-14H2,1-2H3,(H,29,32)/t15-,20+,22+/m0/s1 |
| InChIKey | XSSHRPPOIVBOPI-ZAOYMGCJSA-N |
| XLogP | 4.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |