C26H32F3N3O — CID 98624274
(4aS,5S)-N-(3-methylbutyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 98624274) has the molecular formula C26H32F3N3O and a molecular weight of 459.56 g/mol. Its IUPAC name is (4aS,5S)-N-(3-methylbutyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-N-(3-methylbutyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 98624274 |
| Molecular Formula | C26H32F3N3O |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | (4aS,5S)-N-(3-methylbutyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | Cc1ccc(N2CCN3c4ccc(C(F)(F)F)cc4C[C@H](C(=O)NCCC(C)C)[C@H]3C2)cc1 |
| InChI | InChI=1S/C26H32F3N3O/c1-17(2)10-11-30-25(33)22-15-19-14-20(26(27,28)29)6-9-23(19)32-13-12-31(16-24(22)32)21-7-4-18(3)5-8-21/h4-9,14,17,22,24H,10-13,15-16H2,1-3H3,(H,30,33)/t22-,24+/m0/s1 |
| InChIKey | HDRBHFAGKXOZHL-LADGPHEKSA-N |
| XLogP | 5.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|